![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Bioproduct Engineering, Paper and Packaging .pdf | 2022-06-12 09:12 | 448K | |
| Clean Energy and Sustainable Development .pdf | 2022-06-12 09:12 | 518K | |
| Fine Organic Synthesis.pdf | 2022-06-12 09:12 | 448K | |
| Fuels and Bioenergy Technologies.pdf | 2022-06-12 09:12 | 580K | |
| Industrial Safety.pdf | 2022-06-12 09:12 | 451K | |
| Perfumery and Cosmetics.pdf | 2022-06-12 09:12 | 453K | |
| Polymers Engineering.pdf | 2022-06-12 09:12 | 539K | |
| Technology of Glass, Ceramics and Binding Substances.pdf | 2022-06-12 09:12 | 526K | |
| Automation and Information Technologies.pdf | 2022-06-12 09:14 | 471K | |
| Biomedical Engineering.pdf | 2022-06-12 09:14 | 456K | |
| Biotechnology.pdf | 2022-06-12 09:14 | 454K | |
| Chemical Engineering.pdf | 2022-06-12 09:14 | 519K | |
| Digital and Conventional Printing Technologies and Design.pdf | 2022-06-12 09:14 | 525K | |
| Ecological Engineering and Environmental Protection.pdf | 2022-06-12 09:14 | 445K | |
| Industrial Management.pdf | 2022-06-12 09:14 | 505K | |
| Informatics Engineering.pdf | 2022-06-12 09:14 | 472K | |